Difference between revisions of "CARNITINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite INDOLE == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-4 ==
+
== Metabolite INDOLE ==
 
* common-name:
 
* common-name:
** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** indole
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
+
** c2(c=cc1(=c(c=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** mfdugtooxgorrx-orglzdqcsa-n
+
** sikjaqjrhwyjai-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 382.542
+
** 117.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[INDOLE-23-DIOXYGENASE-RXN]]
 +
* [[RXN0-2381]]
 +
* [[RXN0-2382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[RXN0-2381]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
{{#set: common-name=indole}}
{{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}}
+
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
{{#set: molecular-weight=382.542}}
+
{{#set: molecular-weight=117.15}}

Revision as of 13:13, 14 January 2021

Metabolite INDOLE

  • common-name:
    • indole
  • smiles:
    • c2(c=cc1(=c(c=cn1)c=2))
  • inchi-key:
    • sikjaqjrhwyjai-uhfffaoysa-n
  • molecular-weight:
    • 117.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality