Difference between revisions of "CARNOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-SERINE == * common-name: ** d-serine * smiles: ** c(o)c([n+])c([o-])=o * inchi-key: ** mtcfgrxmjlqnbg-uwtatzphsa-n * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite CARNOSINE == * common-name: ** carnosine * smiles: ** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+] * inchi-key: ** cqovpnpjlqnmdc-zetcqymhsa-n...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-SERINE ==
+
== Metabolite CARNOSINE ==
 
* common-name:
 
* common-name:
** d-serine
+
** carnosine
 
* smiles:
 
* smiles:
** c(o)c([n+])c([o-])=o
+
** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
 
* inchi-key:
 
* inchi-key:
** mtcfgrxmjlqnbg-uwtatzphsa-n
+
** cqovpnpjlqnmdc-zetcqymhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 105.093
+
** 226.235
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DSERDEAM-RXN]]
+
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
* [[RXN-15581]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.1.1.18-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-serine}}
+
{{#set: common-name=carnosine}}
{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-uwtatzphsa-n}}
+
{{#set: inchi-key=inchikey=cqovpnpjlqnmdc-zetcqymhsa-n}}
{{#set: molecular-weight=105.093}}
+
{{#set: molecular-weight=226.235}}

Latest revision as of 11:16, 18 March 2021

Metabolite CARNOSINE

  • common-name:
    • carnosine
  • smiles:
    • c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
  • inchi-key:
    • cqovpnpjlqnmdc-zetcqymhsa-n
  • molecular-weight:
    • 226.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality