Difference between revisions of "CATECHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1103 == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) * inchi-key: ** nvltyojhpbmilu-gmdx...") |
(Created page with "Category:metabolite == Metabolite CATECHOL == * common-name: ** catechol * smiles: ** c1(c=cc(=c(c=1)o)o) * inchi-key: ** ycimnllnpgfghc-uhfffaoysa-n * molecular-weight: *...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CATECHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** catechol |
* smiles: | * smiles: | ||
| − | ** c1(c=c( | + | ** c1(c=cc(=c(c=1)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ycimnllnpgfghc-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 110.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.3.1.20-RXN]] | ||
| + | * [[RXN-3661]] | ||
| + | * [[SALICYLATE-1-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=catechol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ycimnllnpgfghc-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=110.112}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CATECHOL
- common-name:
- catechol
- smiles:
- c1(c=cc(=c(c=1)o)o)
- inchi-key:
- ycimnllnpgfghc-uhfffaoysa-n
- molecular-weight:
- 110.112
