Difference between revisions of "CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: ** ydbyjhtyshbbau-yfkpbyrvsa-o *...")
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-397 ==
+
== Metabolite CPD-4822 ==
 
* common-name:
 
* common-name:
** s-methyl-l-methionine
+
** kanamycin b
 
* smiles:
 
* smiles:
** c[s+](ccc([n+])c(=o)[o-])c
+
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
* inchi-key:
** ydbyjhtyshbbau-yfkpbyrvsa-o
+
** skklouvuunmcje-fqsmhnglsa-s
 
* molecular-weight:
 
* molecular-weight:
** 164.242
+
** 488.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MMUM-RXN]]
+
* [[RXN-14553]]
 +
* [[RXN-15287]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-methyl-l-methionine}}
+
{{#set: common-name=kanamycin b}}
{{#set: inchi-key=inchikey=ydbyjhtyshbbau-yfkpbyrvsa-o}}
+
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
{{#set: molecular-weight=164.242}}
+
{{#set: molecular-weight=488.557}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-4822

  • common-name:
    • kanamycin b
  • smiles:
    • c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • skklouvuunmcje-fqsmhnglsa-s
  • molecular-weight:
    • 488.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality