Difference between revisions of "CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: ** ydbyjhtyshbbau-yfkpbyrvsa-o *...") |
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-4822 == |
* common-name: | * common-name: | ||
− | ** | + | ** kanamycin b |
* smiles: | * smiles: | ||
− | ** c[ | + | ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+])) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** skklouvuunmcje-fqsmhnglsa-s |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 488.557 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14553]] |
+ | * [[RXN-15287]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=kanamycin b}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=488.557}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-4822
- common-name:
- kanamycin b
- smiles:
- c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- skklouvuunmcje-fqsmhnglsa-s
- molecular-weight:
- 488.557