Difference between revisions of "CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
(Created page with "Category:metabolite == Metabolite CD-S-SP-Complex == * common-name: ** a [cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reaction(s) known...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CD-S-SP-Complex == |
* common-name: | * common-name: | ||
− | ** | + | ** a [cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14385]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CD-S-SP-Complex
- common-name:
- a [cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.