Difference between revisions of "CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21215 == * transcription-direction: ** negative * right-end-position: ** 394354 * left-end-position: ** 382280 * centisome-position: ** 63.617165...")
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21215 ==
+
== Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** preq1
−
* right-end-position:
+
* smiles:
−
** 394354
+
** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
−
* left-end-position:
+
* inchi-key:
−
** 382280
+
** meymblgokydglz-uhfffaoysa-o
−
* centisome-position:
+
* molecular-weight:
−
** 63.617165   
+
** 180.189
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-1321]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=preq1}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}}
−
* [[ALKAPHOSPHA-RXN]]
+
{{#set: molecular-weight=180.189}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-5822]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8748]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[NAD-BIOSYNTHESIS-II]]
 
−
** '''4''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NADPHOS-DEPHOS-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5491]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=394354}}
 
−
{{#set: left-end-position=382280}}
 
−
{{#set: centisome-position=63.617165    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:34, 18 December 2020

Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE

  • common-name:
    • preq1
  • smiles:
    • c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
  • inchi-key:
    • meymblgokydglz-uhfffaoysa-o
  • molecular-weight:
    • 180.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CD-S-SP-Complex&oldid=47033"