Difference between revisions of "CDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...") |
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CDP == |
* common-name: | * common-name: | ||
− | ** | + | ** cdp |
+ | * smiles: | ||
+ | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o | ||
+ | * inchi-key: | ||
+ | ** zwiadyzpowuwew-xvfcmesisa-k | ||
+ | * molecular-weight: | ||
+ | ** 400.155 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ATCD]] |
− | * [[RXN- | + | * [[ATCDm]] |
+ | * [[CDPKIN-RXN]] | ||
+ | * [[CDPREDUCT-RXN]] | ||
+ | * [[DCDT]] | ||
+ | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] | ||
+ | * [[RXN-12198]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATCM]] |
− | * [[RXN | + | * [[DOLICHOL-KINASE-RXN]] |
− | * [[RXN- | + | * [[RXN-11832]] |
− | * [[RXN- | + | * [[RXN-12195]] |
− | * [[RXN- | + | * [[RXN-12959]] |
− | * [[RXN- | + | * [[RXN-15091]] |
− | * [[RXN- | + | * [[RXN-7683]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cdp}} |
+ | {{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}} | ||
+ | {{#set: molecular-weight=400.155}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CDP
- common-name:
- cdp
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- zwiadyzpowuwew-xvfcmesisa-k
- molecular-weight:
- 400.155