Difference between revisions of "CDP"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite ADENOSYL-P4 ==
+== Metabolite CDP ==
 * common-name:
-** 5',5'''-diadenosine tetraphosphate
+** cdp
 * smiles:
-** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
+** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 * inchi-key:
-** yoahknvsncmzgq-xpwfqurosa-j
+** zwiadyzpowuwew-xvfcmesisa-k
 * molecular-weight:
-** 832.36
+** 400.155
 == Reaction(s) known to consume the compound ==
-* [[3.6.1.41-RXN]]
+* [[ATCD]]
-* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+* [[ATCDm]]
+* [[CDPKIN-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[DCDT]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+* [[RXN-12198]]
 == Reaction(s) known to produce the compound ==
-* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+* [[ATCM]]
+* [[DOLICHOL-KINASE-RXN]]
+* [[RXN-11832]]
+* [[RXN-12195]]
+* [[RXN-12959]]
+* [[RXN-15091]]
+* [[RXN-7683]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
+{{#set: common-name=cdp}}
-{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
+{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
-{{#set: molecular-weight=832.36}}
+{{#set: molecular-weight=400.155}}