Difference between revisions of "CDP-2-3-4-Saturated-Diacylglycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...")
(Created page with "Category:metabolite == Metabolite CPD-8161 == * common-name: ** 1-18:2-2-16:0-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(=o)occ(coc2(oc(coc1(oc(co)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE ==
+
== Metabolite CPD-8161 ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-phosphate
+
** 1-18:2-2-16:0-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
+
** cccccc=ccc=ccccccccc(=o)occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)ccccccccccccccc
 
* inchi-key:
 
* inchi-key:
** aokqnzvjjxpuqa-kqynxxcusa-m
+
** uzxcpfisfmjpav-gnspkctrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 376.242
+
** 917.225
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12826]]
+
* [[RXN-8364]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12826]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-phosphate}}
+
{{#set: common-name=1-18:2-2-16:0-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=uzxcpfisfmjpav-gnspkctrsa-n}}
{{#set: molecular-weight=376.242}}
+
{{#set: molecular-weight=917.225}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-8161

  • common-name:
    • 1-18:2-2-16:0-digalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(=o)occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)ccccccccccccccc
  • inchi-key:
    • uzxcpfisfmjpav-gnspkctrsa-n
  • molecular-weight:
    • 917.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality