Difference between revisions of "CDP-CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8974 == * common-name: ** dimethylthiophosphate * smiles: ** cop([o-])(=s)oc * inchi-key: ** wwjjvkaeqggyhj-uhfffaoysa-m * molecular-...")
(Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n)) * inc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8974 ==
+
== Metabolite CDP-CHOLINE ==
 
* common-name:
 
* common-name:
** dimethylthiophosphate
+
** cdp-choline
 
* smiles:
 
* smiles:
** cop([o-])(=s)oc
+
** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n))
 
* inchi-key:
 
* inchi-key:
** wwjjvkaeqggyhj-uhfffaoysa-m
+
** rzzpdxzprhqocg-ojakkhqrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 141.101
+
** 487.319
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[RXN-17733]]
 +
* [[RXN-5781]]
 +
* [[RXN-9614]]
 +
* [[RXN66-578]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8743]]
+
* [[2.7.7.15-RXN]]
 +
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[CHLPCTDh]]
 +
* [[RXN-5781]]
 +
* [[RXN-9614]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dimethylthiophosphate}}
+
{{#set: common-name=cdp-choline}}
{{#set: inchi-key=inchikey=wwjjvkaeqggyhj-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=rzzpdxzprhqocg-ojakkhqrsa-m}}
{{#set: molecular-weight=141.101}}
+
{{#set: molecular-weight=487.319}}

Latest revision as of 11:12, 18 March 2021

Metabolite CDP-CHOLINE

  • common-name:
    • cdp-choline
  • smiles:
    • c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n))
  • inchi-key:
    • rzzpdxzprhqocg-ojakkhqrsa-m
  • molecular-weight:
    • 487.319

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality