Difference between revisions of "CDP-CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite Glycerolipids == * common-name: ** a glycerolipid == Reaction(s) known to consume the compound == * RXN-16042 * RXN-16044 * RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17324 ==
+
== Metabolite Glycerolipids ==
 
* common-name:
 
* common-name:
** 3-oxo adrenoyl-coa
+
** a glycerolipid
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vmajwsswcpbijy-kpovblhlsa-j
 
* molecular-weight:
 
** 1091.996
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16112]]
+
* [[RXN-16042]]
 +
* [[RXN-16044]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16152]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-17688]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16041]]
 +
* [[RXN-16043]]
 +
* [[RXN-16045]]
 +
* [[RXN-16138]]
 +
* [[RXN-16139]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-17688]]
 +
* [[RXN-9670]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=a glycerolipid}}
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
 
{{#set: molecular-weight=1091.996}}
 

Revision as of 15:25, 5 January 2021