Difference between revisions of "CDP-ETHANOLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-68 == * common-name: ** 1-aminocyclopropane-1-carboxylate * smiles: ** c([o-])(=o)c1(cc1)[n+] * inchi-key: ** pajpwumxbyxfcz-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CDP-ETHANOLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cdp-ethanolamine |
* smiles: | * smiles: | ||
| − | ** c([o-]) | + | ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wvimueuqjfpndk-pebgctimsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 445.239 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
| − | + | * [[RXN-17731]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.7.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cdp-ethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=445.239}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CDP-ETHANOLAMINE
- common-name:
- cdp-ethanolamine
- smiles:
- c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
- inchi-key:
- wvimueuqjfpndk-pebgctimsa-m
- molecular-weight:
- 445.239
