Difference between revisions of "CDPDIACYLGLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-356 == * common-name: ** d-arabinono-1,4-lactone * smiles: ** c(o)c1(oc(=o)c(o)c(o)1) * inchi-key: ** cuokhacjlgprhd-jjyyjpossa-n * m...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-356 ==
+
== Metabolite PHOSPHORIBOSYL-ATP ==
 
* common-name:
 
* common-name:
** d-arabinono-1,4-lactone
+
** 1-(5-phospho-β-d-ribosyl)-atp
 
* smiles:
 
* smiles:
** c(o)c1(oc(=o)c(o)c(o)1)
+
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** cuokhacjlgprhd-jjyyjpossa-n
+
** rknhjbvbfhdxgr-keohhstqsa-i
 
* molecular-weight:
 
* molecular-weight:
** 148.115
+
** 714.24
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.3.37-RXN]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[HISTPRATPHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADPART]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-arabinono-1,4-lactone}}
+
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
{{#set: inchi-key=inchikey=cuokhacjlgprhd-jjyyjpossa-n}}
+
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
{{#set: molecular-weight=148.115}}
+
{{#set: molecular-weight=714.24}}

Revision as of 11:15, 15 January 2021

Metabolite PHOSPHORIBOSYL-ATP

  • common-name:
    • 1-(5-phospho-β-d-ribosyl)-atp
  • smiles:
    • c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
  • inchi-key:
    • rknhjbvbfhdxgr-keohhstqsa-i
  • molecular-weight:
    • 714.24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality