Difference between revisions of "CDPDIACYLGLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17545 == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine * smiles: ** c([n+])c(c([o-])=o)nc(=o)c1(oc(...")
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * PHOSPH...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17545 ==
+
== Metabolite CDPDIACYLGLYCEROL ==
 
* common-name:
 
* common-name:
** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
+
** a cdp-diacylglycerol
* smiles:
 
** c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
 
* inchi-key:
 
** neroffugairxgm-wxjvfsnfsa-n
 
* molecular-weight:
 
** 217.181
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16294]]
+
* [[2.7.8.11-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-8141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16294]]
+
* [[CDPDIGLYSYN-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine}}
+
{{#set: common-name=a cdp-diacylglycerol}}
{{#set: inchi-key=inchikey=neroffugairxgm-wxjvfsnfsa-n}}
 
{{#set: molecular-weight=217.181}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CDPDIACYLGLYCEROL

  • common-name:
    • a cdp-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality