Difference between revisions of "CDPDIACYLGLYCEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...") |
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * PHOSPH...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CDPDIACYLGLYCEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cdp-diacylglycerol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.8.11-RXN]] | ||
| + | * [[PHOSPHAGLYPSYN-RXN]] | ||
| + | * [[PHOSPHASERSYN-RXN]] | ||
| + | * [[RXN-8141]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CDPDIGLYSYN-RXN]] |
| + | * [[PHOSPHASERSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cdp-diacylglycerol}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CDPDIACYLGLYCEROL
- common-name:
- a cdp-diacylglycerol
