Difference between revisions of "CELLOBIOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Very-long-chain-fatty-acids == * common-name: ** a very-long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-164...") |
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
||
(6 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CELLOBIOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** β-d-cellobiose |
+ | * smiles: | ||
+ | ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o | ||
+ | * inchi-key: | ||
+ | ** gubgytabksrvrq-qrzgkkjrsa-n | ||
+ | * molecular-weight: | ||
+ | ** 342.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10773]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.2.1.91-RXN]] | ||
+ | * [[RXN-12305]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-d-cellobiose}} |
+ | {{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}} | ||
+ | {{#set: molecular-weight=342.299}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CELLOBIOSE
- common-name:
- β-d-cellobiose
- smiles:
- c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
- inchi-key:
- gubgytabksrvrq-qrzgkkjrsa-n
- molecular-weight:
- 342.299