Difference between revisions of "CELLOBIOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RETINAL == * common-name: ** all-trans-retinal * smiles: ** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o * inchi-key: ** ncycyzxnizjoki-o...") |
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CELLOBIOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-cellobiose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gubgytabksrvrq-qrzgkkjrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10773]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.91-RXN]] |
| − | * [[RXN- | + | * [[RXN-12305]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-cellobiose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CELLOBIOSE
- common-name:
- β-d-cellobiose
- smiles:
- c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
- inchi-key:
- gubgytabksrvrq-qrzgkkjrsa-n
- molecular-weight:
- 342.299
