Difference between revisions of "CELLULOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...")
(Created page with "Category:metabolite == Metabolite CELLULOSE == * common-name: ** cellulose == Reaction(s) known to consume the compound == * CELLULOSE-SYNTHASE-UDP-FORMING-RXN * RXN...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-ISOVALERYL-COA ==
+
== Metabolite CELLULOSE ==
 
* common-name:
 
* common-name:
** 3-hydroxyisovaleryl-coa
+
** cellulose
* smiles:
 
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
 
* inchi-key:
 
** pevzkilcbdeobt-uhfffaoysa-j
 
* molecular-weight:
 
** 863.619
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
* [[RXN-14266]]
+
* [[RXN-2043]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
* [[RXN-14266]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxyisovaleryl-coa}}
+
{{#set: common-name=cellulose}}
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
 
{{#set: molecular-weight=863.619}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CELLULOSE

  • common-name:
    • cellulose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality