Difference between revisions of "CENTFERM-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14202 CPD-14202] == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Benzenediols Benzenediols] == * common-name: ** a benzenediol == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14202 CPD-14202] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Benzenediols Benzenediols] ==
 
* common-name:
 
* common-name:
** l-erythro-7,8-dihydrobiopterin
+
** a benzenediol
* smiles:
 
** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
 
* inchi-key:
 
** femxzdutfrtwpe-dzswipipsa-n
 
* molecular-weight:
 
** 239.233
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[LACCASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7908]]
 
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-erythro-7,8-dihydrobiopterin}}
+
{{#set: common-name=a benzenediol}}
{{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}}
 
{{#set: molecular-weight=239.233}}
 

Revision as of 14:18, 26 August 2019

Metabolite Benzenediols

  • common-name:
    • a benzenediol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality