Difference between revisions of "CGMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...")
(Created page with "Category:metabolite == Metabolite an-iNisup1sup-ethyladenine-in-DNA == * common-name: ** an n1-ethyladenine in dna == Reaction(s) known to consume the compound == * RXN0...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SULFO-CYSTEINE ==
+
== Metabolite an-iNisup1sup-ethyladenine-in-DNA ==
 
* common-name:
 
* common-name:
** s-sulfo-l-cysteine
+
** an n1-ethyladenine in dna
* smiles:
 
** c(c([n+])c(=o)[o-])ss([o-])(=o)=o
 
* inchi-key:
 
** nokpbjyhphhwan-reohclbhsa-m
 
* molecular-weight:
 
** 200.204
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SULFOCYS-RXN]]
+
* [[RXN0-986]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SULFOCYS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfo-l-cysteine}}
+
{{#set: common-name=an n1-ethyladenine in dna}}
{{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}}
 
{{#set: molecular-weight=200.204}}
 

Revision as of 18:56, 14 January 2021

Metabolite an-iNisup1sup-ethyladenine-in-DNA

  • common-name:
    • an n1-ethyladenine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality