Difference between revisions of "CH3-MALONATE-S-ALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17319 == * common-name: ** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cc...")
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17319 ==
+
== Metabolite CPD-4822 ==
 
* common-name:
 
* common-name:
** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate
+
** kanamycin b
 
* smiles:
 
* smiles:
** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccc=ccccccccc)=o
+
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
* inchi-key:
** hhmkvxgzzuomhm-xzrwtqcasa-l
+
** skklouvuunmcje-fqsmhnglsa-s
 
* molecular-weight:
 
* molecular-weight:
** 700.975
+
** 488.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14553]]
 +
* [[RXN-15287]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16077]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=kanamycin b}}
{{#set: inchi-key=inchikey=hhmkvxgzzuomhm-xzrwtqcasa-l}}
+
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
{{#set: molecular-weight=700.975}}
+
{{#set: molecular-weight=488.557}}

Revision as of 11:16, 15 January 2021

Metabolite CPD-4822

  • common-name:
    • kanamycin b
  • smiles:
    • c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • skklouvuunmcje-fqsmhnglsa-s
  • molecular-weight:
    • 488.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality