Difference between revisions of "CH33ADO"

Latest revision as of 11:17, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite ASN ==
+== Metabolite CH33ADO ==
 * common-name:
-** l-asparagine
+** 5'-deoxyadenosine
 * smiles:
-** c(cc(c(=o)[o-])[n+])(n)=o
+** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 * inchi-key:
-** dcxyfedjocdnaf-reohclbhsa-n
+** xgyimtfotbmpfp-kqynxxcusa-n
 * molecular-weight:
-** 132.119
+** 251.244
 == Reaction(s) known to consume the compound ==
-* [[ASPARAGHYD-RXN]]
-* [[ASPARAGINE--TRNA-LIGASE-RXN]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ASNSYNA-RXN]]
+* [[2.8.1.6-RXN]]
-* [[ASNSYNB-RXN]]
+* [[HEMN-RXN]]
-* [[RXN-12460]]
+* [[PYRIMSYN1-RXN]]
-* [[RXN0-6982]]
+* [[RXN-11319]]
+* [[RXN-11586]]
+* [[RXN-14480]]
+* [[RXN-14950]]
+* [[RXN-14957]]
+* [[RXN-14959]]
+* [[RXN-17472]]
+* [[RXN-17473]]
+* [[RXN-8340]]
+* [[RXN0-5063]]
+* [[RXN0-949]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-asparagine}}
+{{#set: common-name=5'-deoxyadenosine}}
-{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
+{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
-{{#set: molecular-weight=132.119}}
+{{#set: molecular-weight=251.244}}