Difference between revisions of "CH33ADO"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] ==
+
== Metabolite CH33ADO ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 5'-deoxyadenosine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.4.11 ec-6.3.4.11]
+
** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[3-methylcrotonoyl-CoA-carboxylase-lysine]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[BIOTIN]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Biotin-EC6-4-1-4]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
+
** xgyimtfotbmpfp-kqynxxcusa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06657]]
+
** 251.244
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ19949]]
+
* [[2.8.1.6-RXN]]
−
** Category: [[orthology]]
+
* [[HEMN-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PYRIMSYN1-RXN]]
−
* Gene: [[SJ10816]]
+
* [[RXN-11319]]
−
** Category: [[orthology]]
+
* [[RXN-11586]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14480]]
−
* Gene: [[SJ07132]]
+
* [[RXN-14950]]
−
** Category: [[orthology]]
+
* [[RXN-14957]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14959]]
−
== Pathway(s) ==
+
* [[RXN-17472]]
−
== Reconstruction information  ==
+
* [[RXN-17473]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-8340]]
−
== External links  ==
+
* [[RXN0-5063]]
−
* LIGAND-RXN:
+
* [[RXN0-949]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R04604 R04604]
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=5'-deoxyadenosine}}
−
{{#set: ec-number=ec-6.3.4.11}}
+
{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
−
{{#set: nb gene associated=4}}
+
{{#set: molecular-weight=251.244}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CH33ADO

  • common-name:
    • 5'-deoxyadenosine
  • smiles:
    • cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • xgyimtfotbmpfp-kqynxxcusa-n
  • molecular-weight:
    • 251.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CH33ADO&oldid=139712"