Difference between revisions of "CH33ADO"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11750 RXN-11750] == * direction: ** left-to-right * common-name: ** very-long-chain 3-hydroxyac...")
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11750 RXN-11750] ==
+
== Metabolite CH33ADO ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** very-long-chain 3-hydroxyacyl-coa dehydratase
+
** 5'-deoxyadenosine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.134 ec-4.2.1.134]
+
** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Very-Long-Chain-3-Hydroxyacyl-CoAs]][c] '''=>''' 1 [[Very-Long-Chain-Trans-23-Dehydroacyl-CoA]][c] '''+''' 1 [[WATER]][c]
+
** xgyimtfotbmpfp-kqynxxcusa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00783]]
+
** 251.244
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ06882]]
+
* [[2.8.1.6-RXN]]
−
** Category: [[annotation]]
+
* [[HEMN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PYRIMSYN1-RXN]]
−
== Pathway(s)  ==
+
* [[RXN-11319]]
−
* [[PWY-5080]], very long chain fatty acid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5080 PWY-5080]
+
* [[RXN-11586]]
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-14480]]
−
== Reconstruction information  ==
+
* [[RXN-14950]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14957]]
−
== External links  ==
+
* [[RXN-14959]]
−
* RHEA:
+
* [[RXN-17472]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=45813 45813]
+
* [[RXN-17473]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-8340]]
−
{{#set: common-name=very-long-chain 3-hydroxyacyl-coa dehydratase}}
+
* [[RXN0-5063]]
−
{{#set: ec-number=ec-4.2.1.134}}
+
* [[RXN0-949]]
−
{{#set: nb gene associated=2}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb pathway associated=1}}
+
{{#set: common-name=5'-deoxyadenosine}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular-weight=251.244}}
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CH33ADO

  • common-name:
    • 5'-deoxyadenosine
  • smiles:
    • cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • xgyimtfotbmpfp-kqynxxcusa-n
  • molecular-weight:
    • 251.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CH33ADO&oldid=139712"