Difference between revisions of "CH33ADO"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Carotenoid-beta-end-group == * common-name: ** a carotenoid β-end group == Reaction(s) known to consume the compound == == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CH33ADO == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-deoxyadenosine |
| + | * smiles: | ||
| + | ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** xgyimtfotbmpfp-kqynxxcusa-n | ||
| + | * molecular-weight: | ||
| + | ** 251.244 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.8.1.6-RXN]] |
| + | * [[HEMN-RXN]] | ||
| + | * [[PYRIMSYN1-RXN]] | ||
| + | * [[RXN-11319]] | ||
| + | * [[RXN-11586]] | ||
| + | * [[RXN-14480]] | ||
| + | * [[RXN-14950]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN-17473]] | ||
| + | * [[RXN-8340]] | ||
| + | * [[RXN0-5063]] | ||
| + | * [[RXN0-949]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-deoxyadenosine}} |
| + | {{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}} | ||
| + | {{#set: molecular-weight=251.244}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CH33ADO
- common-name:
- 5'-deoxyadenosine
- smiles:
- cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- xgyimtfotbmpfp-kqynxxcusa-n
- molecular-weight:
- 251.244
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2.8.1.6-RXN
- HEMN-RXN
- PYRIMSYN1-RXN
- RXN-11319
- RXN-11586
- RXN-14480
- RXN-14950
- RXN-14957
- RXN-14959
- RXN-17472
- RXN-17473
- RXN-8340
- RXN0-5063
- RXN0-949
