Difference between revisions of "CH33ADO"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13935 RXN-13935] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CH33ADO == |
− | * | + | * common-name: |
− | ** | + | ** 5'-deoxyadenosine |
− | * | + | * smiles: |
− | ** | + | ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
− | == Reaction | + | * inchi-key: |
− | + | ** xgyimtfotbmpfp-kqynxxcusa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 251.244 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2.8.1.6-RXN]] |
− | * | + | * [[HEMN-RXN]] |
− | * | + | * [[PYRIMSYN1-RXN]] |
− | * | + | * [[RXN-11319]] |
− | * | + | * [[RXN-11586]] |
− | * | + | * [[RXN-14480]] |
− | + | * [[RXN-14950]] | |
− | * [[ | + | * [[RXN-14957]] |
− | * | + | * [[RXN-14959]] |
− | + | * [[RXN-17472]] | |
− | + | * [[RXN-17473]] | |
− | == | + | * [[RXN-8340]] |
− | {{#set: | + | * [[RXN0-5063]] |
− | {{#set: | + | * [[RXN0-949]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5'-deoxyadenosine}} | |
− | + | {{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}} | |
− | + | {{#set: molecular-weight=251.244}} | |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CH33ADO
- common-name:
- 5'-deoxyadenosine
- smiles:
- cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- xgyimtfotbmpfp-kqynxxcusa-n
- molecular-weight:
- 251.244
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2.8.1.6-RXN
- HEMN-RXN
- PYRIMSYN1-RXN
- RXN-11319
- RXN-11586
- RXN-14480
- RXN-14950
- RXN-14957
- RXN-14959
- RXN-17472
- RXN-17473
- RXN-8340
- RXN0-5063
- RXN0-949