Difference between revisions of "CH33ADO"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7224 == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)cccnc(=o)n * inchi-key: ** wmqmioyqxnrroc-lurjtmiesa-...") |
(Created page with "Category:metabolite == Metabolite Carotenoid-beta-end-group == * common-name: ** a carotenoid β-end group == Reaction(s) known to consume the compound == == Reaction(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Carotenoid-beta-end-group == |
* common-name: | * common-name: | ||
| − | ** | + | ** a carotenoid β-end group |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12496]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a carotenoid β-end group}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite Carotenoid-beta-end-group
- common-name:
- a carotenoid β-end group
