Difference between revisions of "CHITIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8132 == * common-name: ** thiophenol * smiles: ** c1(c=cc(=cc=1)[s-]) * inchi-key: ** rmvrsndyefqclf-uhfffaoysa-m * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite CPD-15125 == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] * inchi-key: ** apnidhdqyiszae...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15125 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,4-dihydroxyhept-2-enedioate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** apnidhdqyiszae-hyxafxhysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 188.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14146]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14146]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,4-dihydroxyhept-2-enedioate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=188.137}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-15125
- common-name:
- 2,4-dihydroxyhept-2-enedioate
- smiles:
- c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
- inchi-key:
- apnidhdqyiszae-hyxafxhysa-l
- molecular-weight:
- 188.137
