Difference between revisions of "CHLOROPHYLL-A"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c(=o)(c1(o)(c=cccc(=o)1))[o-] * inchi-key: ** wezwwzku...") |
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CHLOROPHYLL-A == |
+ | * smiles: | ||
+ | ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9)))) | ||
* common-name: | * common-name: | ||
− | ** | + | ** chlorophyll a |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 892.495 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-66]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17428]] |
+ | * [[RXN-7666]] | ||
+ | * [[RXN1F-66]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=chlorophyll a}} |
− | + | {{#set: molecular-weight=892.495}} | |
− | {{#set: molecular-weight= |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CHLOROPHYLL-A
- smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
- common-name:
- chlorophyll a
- molecular-weight:
- 892.495