Difference between revisions of "CHLOROPHYLL-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13376 == * common-name: ** xxlg xyloglucan oligosaccharide * smiles: ** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)o...")
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13376 ==
+
== Metabolite CHLOROPHYLL-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** xxlg xyloglucan oligosaccharide
+
** chlorophyll a
* smiles:
 
** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
 
* inchi-key:
 
** ujniquvnfjifmg-ikgyadnmsa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 1225.073
+
** 892.495
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12398]]
+
* [[RXN1F-66]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17428]]
 +
* [[RXN-7666]]
 +
* [[RXN1F-66]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xxlg xyloglucan oligosaccharide}}
+
{{#set: common-name=chlorophyll a}}
{{#set: inchi-key=inchikey=ujniquvnfjifmg-ikgyadnmsa-n}}
+
{{#set: molecular-weight=892.495}}
{{#set: molecular-weight=1225.073}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CHLOROPHYLL-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • chlorophyll a
  • molecular-weight:
    • 892.495

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality