Difference between revisions of "CHLOROPHYLL-A"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] == * direction: ** left-to-right * common-name: ** 3-oxo-lignoceroyl-coa reduc...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c |
| − | == | + | * inchi-key: |
| − | + | ** swkaczqjgxabcn-jsgwljpksa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 737.203 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-2762]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-2761]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | {{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}} |
| − | * | + | {{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}} |
| − | == | + | {{#set: molecular-weight=737.203}} |
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE
- common-name:
- 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
- inchi-key:
- swkaczqjgxabcn-jsgwljpksa-n
- molecular-weight:
- 737.203
