Difference between revisions of "CHLOROPHYLL-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite DNA-N4-Methylcytosine == * common-name: ** an n4-methylcytosine in dna == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
+
== Metabolite DNA-N4-Methylcytosine ==
 
* common-name:
 
* common-name:
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
+
** an n4-methylcytosine in dna
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
 
* inchi-key:
 
** swkaczqjgxabcn-jsgwljpksa-n
 
* molecular-weight:
 
** 737.203
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2762]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2761]]
+
* [[2.1.1.113-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=an n4-methylcytosine in dna}}
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
 
{{#set: molecular-weight=737.203}}
 

Revision as of 14:58, 5 January 2021

Metabolite DNA-N4-Methylcytosine

  • common-name:
    • an n4-methylcytosine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality