Difference between revisions of "CHLOROPHYLL-B"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)...")
(Created page with "Category:metabolite == Metabolite CPD-177 == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate == Reaction(s) known to consume the compound == * 2.7.1.150-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-130 ==
+
== Metabolite CPD-177 ==
 
* common-name:
 
* common-name:
** zeaxanthin
+
** a 1-phosphatidyl-1d-myo-inositol 3-phosphate
* smiles:
 
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
 
* inchi-key:
 
** jkqxzkusfckogq-qaybqhtqsa-n
 
* molecular-weight:
 
** 568.881
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
+
* [[2.7.1.150-RXN]]
* [[RXN-7978]]
+
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
* [[RXN-7985]]
+
* [[3.1.3.66-RXN]]
* [[RXN-8026]]
 
* [[RXN1F-152]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zeaxanthin}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3-phosphate}}
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
 
{{#set: molecular-weight=568.881}}
 

Revision as of 11:14, 15 January 2021

Metabolite CPD-177

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality