Difference between revisions of "CHLOROPHYLL-B"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08599 == * transcription-direction: ** positive * right-end-position: ** 647130 * left-end-position: ** 636108 * centisome-position: ** 74.06733...")
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ08599 ==
+
== Metabolite CPD-8355 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-18:1-2-lysophosphatidylethanolamine
−
* right-end-position:
+
* smiles:
−
** 647130
+
** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
−
* left-end-position:
+
* inchi-key:
−
** 636108
+
** pyvrvrfvlrnjly-mzmpxxgtsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 74.06733   
+
** 479.593
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15035]]
−
== Reaction(s) associated ==
+
* [[RXN-15036]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
+
* [[RXN-15036]]
−
** Category: [[annotation]]
+
* [[RXN-15067]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=1-18:1-2-lysophosphatidylethanolamine}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}}
−
* [[RXN-12618]]
+
{{#set: molecular-weight=479.593}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-18092]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-6601]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-9157]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN66-336]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7559]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-4041]]
 
−
** '''5''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5826]]
 
−
** '''2''' reactions found over '''14''' reactions in the full pathway
 
−
* [[PWY66-375]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=647130}}
 
−
{{#set: left-end-position=636108}}
 
−
{{#set: centisome-position=74.06733    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-8355

  • common-name:
    • 1-18:1-2-lysophosphatidylethanolamine
  • smiles:
    • ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
  • inchi-key:
    • pyvrvrfvlrnjly-mzmpxxgtsa-n
  • molecular-weight:
    • 479.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CHLOROPHYLL-B&oldid=46371"