Difference between revisions of "CHLOROPHYLLIDE-A"

Latest revision as of 11:15, 18 March 2021

smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
common-name:
- chlorophyllide a
molecular-weight:
- 612.967

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14123 ==
+== Metabolite CHLOROPHYLLIDE-A ==
+* smiles:
+** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 * common-name:
-** 3-amino-2,3-dideoxy-scyllo-inosose
+** chlorophyllide a
-* smiles:
-** c1(c([n+])c(o)c(o)c(o)c(=o)1)
-* inchi-key:
-** fsugckmutgkwie-ygivhsipsa-o
 * molecular-weight:
-** 162.165
+** 612.967
 == Reaction(s) known to consume the compound ==
+* [[RXN-13398]]
+* [[RXN-7663]]
+* [[RXN-7676]]
+* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13118]]
+* [[RXN-5286]]
+* [[RXN1F-10]]
+* [[RXN1F-66]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
+{{#set: common-name=chlorophyllide a}}
-{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
+{{#set: molecular-weight=612.967}}
-{{#set: molecular-weight=162.165}}