Difference between revisions of "CHOCOLA A"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...") |
(Created page with "Category:metabolite == Metabolite CPD-941 == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(sccc(ccccc(n)=o)s)=o)c * inchi-key: ** ufncwfssegpj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-941 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** s-(2-methylbutanoyl)-dihydrolipoamide |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c(sccc(ccccc(n)=o)s)=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufncwfssegpjnl-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 291.466 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=291.466}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-941
- common-name:
- s-(2-methylbutanoyl)-dihydrolipoamide
- smiles:
- ccc(c(sccc(ccccc(n)=o)s)=o)c
- inchi-key:
- ufncwfssegpjnl-uhfffaoysa-n
- molecular-weight:
- 291.466
