Difference between revisions of "CHOCOLA A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite CHOCOLA_A == * common-name: ** all-trans-retinyl palmitate * smiles: ** cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o * inch...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE ==
+
== Metabolite CHOCOLA_A ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
+
** all-trans-retinyl palmitate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
+
** cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o
 
* inchi-key:
 
* inchi-key:
** czfrmaseeptbaq-mycgwmctsa-n
+
** vygqutwhthxgqb-ffhknekcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 685.084
+
** 524.869
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
* [[3.1.1.64-RXN]]
 +
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12547]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=all-trans-retinyl palmitate}}
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
+
{{#set: inchi-key=inchikey=vygqutwhthxgqb-ffhknekcsa-n}}
{{#set: molecular-weight=685.084}}
+
{{#set: molecular-weight=524.869}}

Latest revision as of 11:17, 18 March 2021

Metabolite CHOCOLA_A

  • common-name:
    • all-trans-retinyl palmitate
  • smiles:
    • cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o
  • inchi-key:
    • vygqutwhthxgqb-ffhknekcsa-n
  • molecular-weight:
    • 524.869

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality