Difference between revisions of "CHOCOLA A"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-941 == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(sccc(ccccc(n)=o)s)=o)c * inchi-key: ** ufncwfssegpj...") |
(Created page with "Category:metabolite == Metabolite CHOCOLA_A == * common-name: ** all-trans-retinyl palmitate * smiles: ** cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHOCOLA_A == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-retinyl palmitate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vygqutwhthxgqb-ffhknekcsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 524.869 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.1.64-RXN]] |
| + | * [[RETINYL-PALMITATE-ESTERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12547]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-retinyl palmitate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vygqutwhthxgqb-ffhknekcsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=524.869}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CHOCOLA_A
- common-name:
- all-trans-retinyl palmitate
- smiles:
- cccccccccccccccc(occ=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)=o
- inchi-key:
- vygqutwhthxgqb-ffhknekcsa-n
- molecular-weight:
- 524.869
