Difference between revisions of "CHOCOLA A"

Revision as of 15:30, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite PYRIDOXAMINE-5P ==
+== Metabolite DIACYLGLYCEROL ==
 * common-name:
-** pyridoxamine 5'-phosphate
+** a 1,2-diacyl-sn-glycerol
-* smiles:
-** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
-* inchi-key:
-** zmjgsosnspkhnh-uhfffaoysa-m
-* molecular-weight:
-** 247.167
 == Reaction(s) known to consume the compound ==
-* [[PMPOXI-RXN]]
+* [[2.4.1.46-RXN]]
-* [[PYAMPP]]
+* [[2.7.8.27-RXN]]
-* [[RXN-14046]]
+* [[3.1.4.10-RXN]]
+* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+* [[DIACYLGLYKIN-RXN]]
+* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+* [[RXN-12959]]
+* [[RXN-16261]]
+* [[RXN-5781]]
 == Reaction(s) known to produce the compound ==
-* [[PYRAMKIN-RXN]]
+* [[2.7.8.27-RXN]]
+* [[3.1.4.10-RXN]]
+* [[3.1.4.11-RXN]]
+* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
+* [[PHOSPHOLIPASE-C-RXN]]
+* [[RXN-13334]]
+* [[RXN-15211]]
+* [[RXN-16261]]
+* [[RXN-5781]]
+* [[RXN3O-581]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=pyridoxamine 5'-phosphate}}
+{{#set: common-name=a 1,2-diacyl-sn-glycerol}}
-{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}
-{{#set: molecular-weight=247.167}}