Difference between revisions of "CHOLESTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7524 == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c *...") |
(Created page with "Category:metabolite == Metabolite CHOLESTEROL == * common-name: ** cholesterol * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHOLESTEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** cholesterol |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hvywmomldimfja-dpaqbdifsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 386.66 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.14.99.38-RXN]] |
| + | * [[RXN-12127]] | ||
| + | * [[RXN-12693]] | ||
| + | * [[RXN-12701]] | ||
| + | * [[RXN-17655]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12693]] |
| + | * [[RXN66-28]] | ||
| + | * [[RXN66-323]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cholesterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hvywmomldimfja-dpaqbdifsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=386.66}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CHOLESTEROL
- common-name:
- cholesterol
- smiles:
- cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- hvywmomldimfja-dpaqbdifsa-n
- molecular-weight:
- 386.66
