Difference between revisions of "CHOLESTEROL"

Latest revision as of 11:11, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite HEXANOYL-COA ==
+== Metabolite CHOLESTEROL ==
 * common-name:
-** hexanoyl-coa
+** cholesterol
 * smiles:
-** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 * inchi-key:
-** oexfmsfodmqepe-hdrqghtbsa-j
+** hvywmomldimfja-dpaqbdifsa-n
 * molecular-weight:
-** 861.647
+** 386.66
 == Reaction(s) known to consume the compound ==
-* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
+* [[1.14.99.38-RXN]]
-* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
+* [[RXN-12127]]
-* [[RXN-14277]]
+* [[RXN-12693]]
-* [[RXN-14278]]
+* [[RXN-12701]]
-* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
+* [[RXN-17655]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-12559]]
+* [[RXN-12693]]
-* [[RXN-14277]]
+* [[RXN66-28]]
-* [[RXN-14278]]
+* [[RXN66-323]]
-* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=hexanoyl-coa}}
+{{#set: common-name=cholesterol}}
-{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
+{{#set: inchi-key=inchikey=hvywmomldimfja-dpaqbdifsa-n}}
-{{#set: molecular-weight=861.647}}
+{{#set: molecular-weight=386.66}}