Difference between revisions of "CHOLESTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-fragment == * common-name: ** a trna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...") |
(Created page with "Category:metabolite == Metabolite CPD-7524 == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7524 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,9,9'-cis-neurosporene |
| + | * smiles: | ||
| + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** atcicvfrsjqydv-ifjqppewsa-n | ||
| + | * molecular-weight: | ||
| + | ** 538.898 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11357]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11356]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,9,9'-cis-neurosporene}} |
| + | {{#set: inchi-key=inchikey=atcicvfrsjqydv-ifjqppewsa-n}} | ||
| + | {{#set: molecular-weight=538.898}} | ||
Revision as of 15:25, 5 January 2021
Contents
Metabolite CPD-7524
- common-name:
- 7,9,9'-cis-neurosporene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- atcicvfrsjqydv-ifjqppewsa-n
- molecular-weight:
- 538.898
