Difference between revisions of "CHOLESTEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...")
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINATE_NUCLEOTIDE ==
+
== Metabolite HEXANOYL-COA ==
 
* common-name:
 
* common-name:
** β-nicotinate d-ribonucleotide
+
** hexanoyl-coa
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
+
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jouiqrnqjgxqdc-zyuzmqfosa-l
+
** oexfmsfodmqepe-hdrqghtbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 333.191
+
** 861.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
* [[RXN-14227]]
+
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
 +
* [[RXN-14277]]
 +
* [[RXN-14278]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
+
* [[RXN-12559]]
* [[QUINOPRIBOTRANS-RXN]]
+
* [[RXN-14277]]
* [[RXN-8443]]
+
* [[RXN-14278]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinate d-ribonucleotide}}
+
{{#set: common-name=hexanoyl-coa}}
{{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}}
+
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
{{#set: molecular-weight=333.191}}
+
{{#set: molecular-weight=861.647}}

Revision as of 18:53, 14 January 2021

Metabolite HEXANOYL-COA

  • common-name:
    • hexanoyl-coa
  • smiles:
    • cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oexfmsfodmqepe-hdrqghtbsa-j
  • molecular-weight:
    • 861.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality