Difference between revisions of "CHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...") |
(Created page with "Category:metabolite == Metabolite CHOLINE == * common-name: ** choline * smiles: ** c(co)[n+](c)(c)c * inchi-key: ** oeyiohpdsnjkls-uhfffaoysa-n * molecular-weight: ** 104...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** choline |
* smiles: | * smiles: | ||
| − | ** c([n+] | + | ** c(co)[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oeyiohpdsnjkls-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 104.172 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN0- | + | * [[2.3.1.91-RXN]] |
| + | * [[CHD-RXN]] | ||
| + | * [[CHOLINE-KINASE-RXN]] | ||
| + | * [[RXN0-7230]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ACETYLCHOLINESTERASE-RXN]] | ||
| + | * [[CHD-RXN]] | ||
| + | * [[CHOLINESTERASE-RXN]] | ||
| + | * [[PHOSCHOL-RXN]] | ||
| + | * [[RXN-5647]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=choline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oeyiohpdsnjkls-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=104.172}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CHOLINE
- common-name:
- choline
- smiles:
- c(co)[n+](c)(c)c
- inchi-key:
- oeyiohpdsnjkls-uhfffaoysa-n
- molecular-weight:
- 104.172
