Difference between revisions of "CHOLINE-BETAINE-ANA-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13612 CPD-13612] == * common-name: ** d-erythro-sphinganine * smiles: ** cccccccccccccccc(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == |
* common-name: | * common-name: | ||
− | ** d- | + | ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)c(o)c(o)cc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ifmhgoadxgywmo-kvqbguixsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 191.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10032]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=d- | + | {{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=191.183}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-10792
- common-name:
- 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
- smiles:
- cc(=o)c(o)c(o)cc([n+])c([o-])=o
- inchi-key:
- ifmhgoadxgywmo-kvqbguixsa-n
- molecular-weight:
- 191.183