Difference between revisions of "CHOLINE-BETAINE-ANA-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15317 CPD-15317] == * common-name: ** d-ribofuranose 5-phosphate == Reaction(s) known to co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15317 CPD-15317] ==
 
* common-name:
 
* common-name:
** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
+
** d-ribofuranose 5-phosphate
* smiles:
 
** cc(=o)c(o)c(o)cc([n+])c([o-])=o
 
* inchi-key:
 
** ifmhgoadxgywmo-kvqbguixsa-n
 
* molecular-weight:
 
** 191.183
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10032]]
+
* [[RXN0-5398]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-4313]]
 +
* [[RXN0-1441]]
 +
* [[RXN0-5398]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}}
+
{{#set: common-name=d-ribofuranose 5-phosphate}}
{{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}}
 
{{#set: molecular-weight=191.183}}
 

Revision as of 09:22, 27 August 2019

Metabolite CPD-15317

  • common-name:
    • d-ribofuranose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality