Difference between revisions of "CHONDROITIN-46-DISULFATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...") |
(Created page with "Category:metabolite == Metabolite CHONDROITIN-46-DISULFATE == * common-name: ** [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine == Reaction(s) known to consume the c...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CHONDROITIN-46-DISULFATE == |
* common-name: | * common-name: | ||
− | ** | + | ** [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7954]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CHONDROITIN-46-DISULFATE
- common-name:
- [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.