Difference between revisions of "CHONDROITIN-46-DISULFATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CHONDROITIN-46-DISULFATE == * common-name: ** [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine == Reaction(s) known to consume the c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHONDROITIN-46-DISULFATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7954]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CHONDROITIN-46-DISULFATE
- common-name:
- [chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "chondroitin]-4,6-di-o-sulfo-n-acetyl-d-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
