Difference between revisions of "CHORISMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Lysine == * common-name: ** [fructose-bisphosphate aldolase]-lysine == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Fructose-BisPO4-Aldolase-Lysine ==
+
== Metabolite CHORISMATE ==
 
* common-name:
 
* common-name:
** [fructose-bisphosphate aldolase]-lysine
+
** chorismate
 +
* smiles:
 +
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
 +
* inchi-key:
 +
** wtfxtqvdakgdey-htqzyqbosa-l
 +
* molecular-weight:
 +
** 224.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13588]]
+
* [[ANTHRANSYN-RXN]]
 +
* [[CHORISMATEMUT-RXN]]
 +
* [[ISOCHORSYN-RXN]]
 +
* [[PABASYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ANTHRANSYN-RXN]]
 +
* [[CHORISMATE-SYNTHASE-RXN]]
 +
* [[CHORISMATEMUT-RXN]]
 +
* [[ISOCHORSYN-RXN]]
 +
* [[PABASYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[fructose-bisphosphate aldolase]-lysine}}
+
{{#set: common-name=chorismate}}
 +
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
 +
{{#set: molecular-weight=224.17}}

Revision as of 11:19, 15 January 2021

Metabolite CHORISMATE

  • common-name:
    • chorismate
  • smiles:
    • c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
  • inchi-key:
    • wtfxtqvdakgdey-htqzyqbosa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality