Difference between revisions of "CHORISMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PI G6PI] == * direction: ** reversible * common-name: ** glucose-6-phosphate isomerase == Reactio...")
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PI G6PI] ==
+
== Metabolite CHORISMATE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** glucose-6-phosphate isomerase
+
** chorismate
== Reaction formula ==
+
* smiles:
* 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[GLC-6-P]][c]
+
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ08179]]
+
** wtfxtqvdakgdey-htqzyqbosa-l
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 224.17
* Gene: [[SJ00085]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[ANTHRANSYN-RXN]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[CHORISMATEMUT-RXN]]
== Pathway(s) ==
+
* [[ISOCHORSYN-RXN]]
== Reconstruction information  ==
+
* [[PABASYN-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[ANTHRANSYN-RXN]]
{{#set: direction=reversible}}
+
* [[CHORISMATE-SYNTHASE-RXN]]
{{#set: common-name=glucose-6-phosphate isomerase}}
+
* [[CHORISMATEMUT-RXN]]
{{#set: nb gene associated=2}}
+
* [[ISOCHORSYN-RXN]]
{{#set: nb pathway associated=0}}
+
* [[PABASYN-RXN]]
{{#set: reconstruction category=orthology}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction tool=pantograph}}
+
{{#set: common-name=chorismate}}
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
{{#set: molecular-weight=224.17}}

Latest revision as of 11:17, 18 March 2021

Metabolite CHORISMATE

  • common-name:
    • chorismate
  • smiles:
    • c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
  • inchi-key:
    • wtfxtqvdakgdey-htqzyqbosa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality